C22H30ClNO2 — CID 166642340
[(6S)-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride (PubChem CID 166642340) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is [(6S)-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride.
| Compound Name | [(6S)-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 166642340 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | [(6S)-6-(methylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride |
| SMILES | CCC(OC(C)=O)C(C[C@H](C)NC)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C22H29NO2.ClH/c1-5-21(25-18(3)24)22(16-17(2)23-4,19-12-8-6-9-13-19)20-14-10-7-11-15-20;/h6-15,17,21,23H,5,16H2,1-4H3;1H/t17-,21?;/m0./s1 |
| InChIKey | QOWPUUFVFLIYRR-JJTBHEEUSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |