C19H17N5OS — CID 166642744
4-(3-aminophenyl)-6-(4-methoxyanilino)-2-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 166642744) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-(3-aminophenyl)-6-(4-methoxyanilino)-2-methylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-(3-aminophenyl)-6-(4-methoxyanilino)-2-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 166642744 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-(3-aminophenyl)-6-(4-methoxyanilino)-2-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | COc1ccc(Nc2nc(SC)nc(-c3cccc(N)c3)c2C#N)cc1 |
| InChI | InChI=1S/C19H17N5OS/c1-25-15-8-6-14(7-9-15)22-18-16(11-20)17(23-19(24-18)26-2)12-4-3-5-13(21)10-12/h3-10H,21H2,1-2H3,(H,22,23,24) |
| InChIKey | OVTASJBPUZDRKR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|