C22H20N4O2S — CID 7718754
ethyl 4-[[5-cyano-6-(4-methylphenyl)-2-methylsulfanylpyrimidin-4-yl]amino]benzoate (PubChem CID 7718754) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is ethyl 4-[[5-cyano-6-(4-methylphenyl)-2-methylsulfanylpyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-cyano-6-(4-methylphenyl)-2-methylsulfanylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 7718754 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 4-[[5-cyano-6-(4-methylphenyl)-2-methylsulfanylpyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(SC)nc(-c3ccc(C)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C22H20N4O2S/c1-4-28-21(27)16-9-11-17(12-10-16)24-20-18(13-23)19(25-22(26-20)29-3)15-7-5-14(2)6-8-15/h5-12H,4H2,1-3H3,(H,24,25,26) |
| InChIKey | KXQYWQWVPOQFBD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |