C22H30ClN7O4 — CID 166646958
N-[5-[amino(hydroxy)methyl]-7-[3-[(2-chloroacetyl)amino]propoxy]-1-ethylbenzimidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide (PubChem CID 166646958) has the molecular formula C22H30ClN7O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[5-[amino(hydroxy)methyl]-7-[3-[(2-chloroacetyl)amino]propoxy]-1-ethylbenzimidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide.
| Compound Name | N-[5-[amino(hydroxy)methyl]-7-[3-[(2-chloroacetyl)amino]propoxy]-1-ethylbenzimidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166646958 |
| Molecular Formula | C22H30ClN7O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[5-[amino(hydroxy)methyl]-7-[3-[(2-chloroacetyl)amino]propoxy]-1-ethylbenzimidazol-2-yl]-2-ethyl-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)O)cc(OCCCNC(=O)CCl)c2n1CC |
| InChI | InChI=1S/C22H30ClN7O4/c1-4-29-19-15(26-22(29)27-21(33)16-9-13(3)28-30(16)5-2)10-14(20(24)32)11-17(19)34-8-6-7-25-18(31)12-23/h9-11,20,32H,4-8,12,24H2,1-3H3,(H,25,31)(H,26,27,33) |
| InChIKey | RASDAWDRWWZAMJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|