About 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole
7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole (PubChem CID 166649819) has the molecular formula C14H8N2O2
and a molecular weight of 236.23 g/mol. Its IUPAC name is 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole |
| PubChem CID | 166649819 |
| Molecular Formula | C14H8N2O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole |
| SMILES | c1cc(-c2cccc3ncoc23)c2oncc2c1 |
| InChI | InChI=1S/C14H8N2O2/c1-3-9-7-16-18-13(9)10(4-1)11-5-2-6-12-14(11)17-8-15-12/h1-8H |
| InChIKey | YAAFUSDENPAJLQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole?
The IUPAC name of 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole (CID 166649819) is 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole.
What is the SMILES notation for 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole?
The canonical SMILES for 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole is c1cc(-c2cccc3ncoc23)c2oncc2c1.
What is the InChIKey of 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole?
The InChIKey is YAAFUSDENPAJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O2/c1-3-9-7-16-18-13(9)10(4-1)11-5-2-6-12-14(11)17-8-15-12/h1-8H.
What are the key properties of 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole?
7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole has a molecular weight of 236.23 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,2-benzoxazol-7-yl)-1,3-benzoxazole is sourced from PubChem (CID 166649819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).