About 3-phthalazin-6-yl-1,8-naphthyridine
3-phthalazin-6-yl-1,8-naphthyridine (PubChem CID 166653985) has the molecular formula C16H10N4
and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-phthalazin-6-yl-1,8-naphthyridine.
Molecular Properties
| Compound Name | 3-phthalazin-6-yl-1,8-naphthyridine |
| PubChem CID | 166653985 |
| Molecular Formula | C16H10N4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-phthalazin-6-yl-1,8-naphthyridine |
| SMILES | c1cnc2ncc(-c3ccc4cnncc4c3)cc2c1 |
| InChI | InChI=1S/C16H10N4/c1-2-12-7-14(8-18-16(12)17-5-1)11-3-4-13-9-19-20-10-15(13)6-11/h1-10H |
| InChIKey | NPYLASWWRAYIHY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phthalazin-6-yl-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phthalazin-6-yl-1,8-naphthyridine?
The IUPAC name of 3-phthalazin-6-yl-1,8-naphthyridine (CID 166653985) is 3-phthalazin-6-yl-1,8-naphthyridine.
What is the SMILES notation for 3-phthalazin-6-yl-1,8-naphthyridine?
The canonical SMILES for 3-phthalazin-6-yl-1,8-naphthyridine is c1cnc2ncc(-c3ccc4cnncc4c3)cc2c1.
What is the InChIKey of 3-phthalazin-6-yl-1,8-naphthyridine?
The InChIKey is NPYLASWWRAYIHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4/c1-2-12-7-14(8-18-16(12)17-5-1)11-3-4-13-9-19-20-10-15(13)6-11/h1-10H.
What are the key properties of 3-phthalazin-6-yl-1,8-naphthyridine?
3-phthalazin-6-yl-1,8-naphthyridine has a molecular weight of 258.28 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phthalazin-6-yl-1,8-naphthyridine is sourced from PubChem (CID 166653985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).