C15H19N3O3 — CID 166654882
methyl 3-(3,4-dihydropyridin-2-yl)-6,7,9,10-tetrahydro-5H-imidazo[2,1-d][1,5]oxazocine-2-carboxylate (PubChem CID 166654882) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 3-(3,4-dihydropyridin-2-yl)-6,7,9,10-tetrahydro-5H-imidazo[2,1-d][1,5]oxazocine-2-carboxylate.
| Compound Name | methyl 3-(3,4-dihydropyridin-2-yl)-6,7,9,10-tetrahydro-5H-imidazo[2,1-d][1,5]oxazocine-2-carboxylate |
|---|---|
| PubChem CID | 166654882 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl 3-(3,4-dihydropyridin-2-yl)-6,7,9,10-tetrahydro-5H-imidazo[2,1-d][1,5]oxazocine-2-carboxylate |
| SMILES | COC(=O)c1nc2n(c1C1=NC=CCC1)CCCOCC2 |
| InChI | InChI=1S/C15H19N3O3/c1-20-15(19)13-14(11-5-2-3-7-16-11)18-8-4-9-21-10-6-12(18)17-13/h3,7H,2,4-6,8-10H2,1H3 |
| InChIKey | NPYKZFDUKYUNQE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |