C21H29NO2 — CID 166655492
(8S,10S,13S)-8,10,11,13-tetramethyl-17-nitroso-2,6,7,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 166655492) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (8S,10S,13S)-8,10,11,13-tetramethyl-17-nitroso-2,6,7,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S)-8,10,11,13-tetramethyl-17-nitroso-2,6,7,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 166655492 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (8S,10S,13S)-8,10,11,13-tetramethyl-17-nitroso-2,6,7,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1=C2[C@@]3(C)CCC(=O)C=C3CC[C@@]2(C)C2CCC(N=O)[C@@]2(C)C1 |
| InChI | InChI=1S/C21H29NO2/c1-13-12-21(4)16(5-6-17(21)22-24)20(3)9-7-14-11-15(23)8-10-19(14,2)18(13)20/h11,16-17H,5-10,12H2,1-4H3/t16?,17?,19-,20-,21-/m0/s1 |
| InChIKey | DOTFZFLZBJWOIN-WPZPHBQUSA-N |
| XLogP | 5.35 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|