C25H28F3N — CID 166656490
4-[(1E,3Z,5E)-4-methyl-5-(3,4,5-trimethylcyclohepta-1,3,6-trien-1-yl)octa-1,3,5,7-tetraenyl]-6-(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 166656490) has the molecular formula C25H28F3N and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[(1E,3Z,5E)-4-methyl-5-(3,4,5-trimethylcyclohepta-1,3,6-trien-1-yl)octa-1,3,5,7-tetraenyl]-6-(trifluoromethyl)-1,2-dihydropyridine.
| Compound Name | 4-[(1E,3Z,5E)-4-methyl-5-(3,4,5-trimethylcyclohepta-1,3,6-trien-1-yl)octa-1,3,5,7-tetraenyl]-6-(trifluoromethyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 166656490 |
| Molecular Formula | C25H28F3N |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 4-[(1E,3Z,5E)-4-methyl-5-(3,4,5-trimethylcyclohepta-1,3,6-trien-1-yl)octa-1,3,5,7-tetraenyl]-6-(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | C=C/C=C(C1=CC(C)=C(C)C(C)C=C1)\C(C)=C/C=C/C1=CCNC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C25H28F3N/c1-6-8-23(22-12-11-17(2)20(5)19(4)15-22)18(3)9-7-10-21-13-14-29-24(16-21)25(26,27)28/h6-13,15-17,29H,1,14H2,2-5H3/b10-7+,18-9-,23-8+ |
| InChIKey | VWPYMGULJHVBJD-RUPKPODFSA-N |
| XLogP | 7.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|