C19H21F4N5O2 — CID 166657661
N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-formamidopropyl)-3-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 166657661) has the molecular formula C19H21F4N5O2 and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-formamidopropyl)-3-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-formamidopropyl)-3-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 166657661 |
| Molecular Formula | C19H21F4N5O2 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-formamidopropyl)-3-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | Cc1c2c(nn1CCCNC=O)CCN(C(=O)Nc1ccc(F)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C19H21F4N5O2/c1-12-14-10-27(8-5-17(14)26-28(12)7-2-6-24-11-29)18(30)25-13-3-4-16(20)15(9-13)19(21,22)23/h3-4,9,11H,2,5-8,10H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | TZIKAXKUMOSGDK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|