About 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate
1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate (PubChem CID 166658163) has the molecular formula C8H19NO2S2
and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate.
Molecular Properties
| Compound Name | 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate |
| PubChem CID | 166658163 |
| Molecular Formula | C8H19NO2S2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate |
| SMILES | CC(CS(C)(C)S)OC(=O)C(C)N |
| InChI | InChI=1S/C8H19NO2S2/c1-6(5-13(3,4)12)11-8(10)7(2)9/h6-7,12H,5,9H2,1-4H3 |
| InChIKey | QHCSBTORHIFIDF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate?
The IUPAC name of 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate (CID 166658163) is 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate.
What is the SMILES notation for 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate?
The canonical SMILES for 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate is CC(CS(C)(C)S)OC(=O)C(C)N.
What is the InChIKey of 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate?
The InChIKey is QHCSBTORHIFIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2S2/c1-6(5-13(3,4)12)11-8(10)7(2)9/h6-7,12H,5,9H2,1-4H3.
What are the key properties of 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate?
1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate has a molecular weight of 225.38 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dimethyl(sulfanyl)-λ4-sulfanyl]propan-2-yl 2-aminopropanoate is sourced from PubChem (CID 166658163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).