C27H51N3O6 — CID 166661172
3-(3-methyl-2,5-dioxopyrrolidin-1-yl)-N-[3-[3-methyl-3-[[methyl-(4-methyl-2-propan-2-ylpentoxy)amino]methoxy]butoxy]propyl]propanamide (PubChem CID 166661172) has the molecular formula C27H51N3O6 and a molecular weight of 513.72 g/mol. Its IUPAC name is 3-(3-methyl-2,5-dioxopyrrolidin-1-yl)-N-[3-[3-methyl-3-[[methyl-(4-methyl-2-propan-2-ylpentoxy)amino]methoxy]butoxy]propyl]propanamide.
| Compound Name | 3-(3-methyl-2,5-dioxopyrrolidin-1-yl)-N-[3-[3-methyl-3-[[methyl-(4-methyl-2-propan-2-ylpentoxy)amino]methoxy]butoxy]propyl]propanamide |
|---|---|
| PubChem CID | 166661172 |
| Molecular Formula | C27H51N3O6 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | 3-(3-methyl-2,5-dioxopyrrolidin-1-yl)-N-[3-[3-methyl-3-[[methyl-(4-methyl-2-propan-2-ylpentoxy)amino]methoxy]butoxy]propyl]propanamide |
| SMILES | CC(C)CC(CON(C)COC(C)(C)CCOCCCNC(=O)CCN1C(=O)CC(C)C1=O)C(C)C |
| InChI | InChI=1S/C27H51N3O6/c1-20(2)16-23(21(3)4)18-36-29(8)19-35-27(6,7)11-15-34-14-9-12-28-24(31)10-13-30-25(32)17-22(5)26(30)33/h20-23H,9-19H2,1-8H3,(H,28,31) |
| InChIKey | RTONDPNJXVNLAY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|