C20H12Cl2F2N4O3 — CID 166662320
6-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-3-yl)pyridine-3-carboxamide (PubChem CID 166662320) has the molecular formula C20H12Cl2F2N4O3 and a molecular weight of 465.24 g/mol. Its IUPAC name is 6-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166662320 |
| Molecular Formula | C20H12Cl2F2N4O3 |
| Molecular Weight | 465.24 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 6-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-5-(5-oxo-6,7-dihydropyrrolo[3,4-b]pyridin-3-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cnc(Cl)c(-c2cnc3c(c2)C(=O)NC3)c1 |
| InChI | InChI=1S/C20H12Cl2F2N4O3/c21-17-14(10-5-15-16(25-7-10)9-27-19(15)30)6-11(8-26-17)18(29)28-12-1-3-13(4-2-12)31-20(22,23)24/h1-8H,9H2,(H,27,30)(H,28,29) |
| InChIKey | PLZRPFLMSSUUMC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|