C21H32N2O2 — CID 16666403
[3-[1-[methyl(prop-2-ynyl)amino]propan-2-yl]phenyl] N-hexyl-N-methylcarbamate (PubChem CID 16666403) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is [3-[1-[methyl(prop-2-ynyl)amino]propan-2-yl]phenyl] N-hexyl-N-methylcarbamate.
| Compound Name | [3-[1-[methyl(prop-2-ynyl)amino]propan-2-yl]phenyl] N-hexyl-N-methylcarbamate |
|---|---|
| PubChem CID | 16666403 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | [3-[1-[methyl(prop-2-ynyl)amino]propan-2-yl]phenyl] N-hexyl-N-methylcarbamate |
| SMILES | C#CCN(C)CC(C)c1cccc(OC(=O)N(C)CCCCCC)c1 |
| InChI | InChI=1S/C21H32N2O2/c1-6-8-9-10-15-23(5)21(24)25-20-13-11-12-19(16-20)18(3)17-22(4)14-7-2/h2,11-13,16,18H,6,8-10,14-15,17H2,1,3-5H3 |
| InChIKey | ZYZQMBZPHQKQHP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|