C27H33BrFIN4O7 — CID 166665024
1-O-tert-butyl 3-O-methyl 3-[7-bromo-8-fluoro-6-iodo-2-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitroquinolin-4-yl]piperidine-1,3-dicarboxylate (PubChem CID 166665024) has the molecular formula C27H33BrFIN4O7 and a molecular weight of 751.39 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 3-[7-bromo-8-fluoro-6-iodo-2-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitroquinolin-4-yl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 3-[7-bromo-8-fluoro-6-iodo-2-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitroquinolin-4-yl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 166665024 |
| Molecular Formula | C27H33BrFIN4O7 |
| Molecular Weight | 751.39 g/mol |
| Exact Mass | 750.06 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 3-[7-bromo-8-fluoro-6-iodo-2-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitroquinolin-4-yl]piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(c2c([N+](=O)[O-])c(OCC3CCCN3C)nc3c(F)c(Br)c(I)cc23)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H33BrFIN4O7/c1-26(2,3)41-25(36)33-11-7-9-27(14-33,24(35)39-5)18-16-12-17(30)19(28)20(29)21(16)31-23(22(18)34(37)38)40-13-15-8-6-10-32(15)4/h12,15H,6-11,13-14H2,1-5H3 |
| InChIKey | POVBBNKLSYHJLY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 124.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|