C33H48BrClFN5O6 — CID 175821948
tert-butyl 4-[7-bromo-8-chloro-6-fluoro-4-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]imidazo[4,5-c]quinolin-1-yl]piperidine-1-carboxylate;diethoxymethoxyethane (PubChem CID 175821948) has the molecular formula C33H48BrClFN5O6 and a molecular weight of 745.13 g/mol. Its IUPAC name is tert-butyl 4-[7-bromo-8-chloro-6-fluoro-4-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]imidazo[4,5-c]quinolin-1-yl]piperidine-1-carboxylate;diethoxymethoxyethane.
| Compound Name | tert-butyl 4-[7-bromo-8-chloro-6-fluoro-4-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]imidazo[4,5-c]quinolin-1-yl]piperidine-1-carboxylate;diethoxymethoxyethane |
|---|---|
| PubChem CID | 175821948 |
| Molecular Formula | C33H48BrClFN5O6 |
| Molecular Weight | 745.13 g/mol |
| Exact Mass | 743.25 |
| IUPAC Name | tert-butyl 4-[7-bromo-8-chloro-6-fluoro-4-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]imidazo[4,5-c]quinolin-1-yl]piperidine-1-carboxylate;diethoxymethoxyethane |
| SMILES | CCOC(OCC)OCC.CN1CCC[C@H]1COc1nc2c(F)c(Br)c(Cl)cc2c2c1ncn2C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H32BrClFN5O3.C7H16O3/c1-26(2,3)37-25(35)33-10-7-15(8-11-33)34-14-30-22-23(34)17-12-18(28)19(27)20(29)21(17)31-24(22)36-13-16-6-5-9-32(16)4;1-4-8-7(9-5-2)10-6-3/h12,14-16H,5-11,13H2,1-4H3;7H,4-6H2,1-3H3/t16-;/m0./s1 |
| InChIKey | GHJMHHXHRHINMJ-NTISSMGPSA-N |
| XLogP | 7.56 |
| TPSA | 100.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.13 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|