C36H47Cl2F2N2O11P — CID 166666316
[(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl] 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]propyl carbonate (PubChem CID 166666316) has the molecular formula C36H47Cl2F2N2O11P and a molecular weight of 823.65 g/mol. Its IUPAC name is [(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl] 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]propyl carbonate.
| Compound Name | [(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl] 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]propyl carbonate |
|---|---|
| PubChem CID | 166666316 |
| Molecular Formula | C36H47Cl2F2N2O11P |
| Molecular Weight | 823.65 g/mol |
| Exact Mass | 822.23 |
| IUPAC Name | [(2S)-1,4-bis[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[2.2.2]octanyl] 3-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]propyl carbonate |
| SMILES | CC(C)(C)OP(=O)(OCCCOC(=O)O[C@H]1CC2(NC(=O)COc3ccc(Cl)c(F)c3)CCC1(NC(=O)COc1ccc(Cl)c(F)c1)CC2)OC(C)(C)C |
| InChI | InChI=1S/C36H47Cl2F2N2O11P/c1-33(2,3)52-54(46,53-34(4,5)6)50-17-7-16-47-32(45)51-29-20-35(41-30(43)21-48-23-8-10-25(37)27(39)18-23)12-14-36(29,15-13-35)42-31(44)22-49-24-9-11-26(38)28(40)19-24/h8-11,18-19,29H,7,12-17,20-22H2,1-6H3,(H,41,43)(H,42,44)/t29-,35?,36?/m0/s1 |
| InChIKey | SZEMNYZQYDVQKZ-KUDCLWHVSA-N |
| XLogP | 8.08 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|