C20H22N2O2S — CID 166667567
methyl (11S,12E)-12-ethylidene-17-thia-8,14-diazapentacyclo[9.6.2.01,9.02,7.014,18]nonadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 166667567) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is methyl (11S,12E)-12-ethylidene-17-thia-8,14-diazapentacyclo[9.6.2.01,9.02,7.014,18]nonadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (11S,12E)-12-ethylidene-17-thia-8,14-diazapentacyclo[9.6.2.01,9.02,7.014,18]nonadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 166667567 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | methyl (11S,12E)-12-ethylidene-17-thia-8,14-diazapentacyclo[9.6.2.01,9.02,7.014,18]nonadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | C/C=C1/CN2CCSC34C(=C(C(=O)OC)[C@H]1CC23)Nc1ccccc14 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-12-11-22-8-9-25-20-14-6-4-5-7-15(14)21-18(20)17(19(23)24-2)13(12)10-16(20)22/h3-7,13,16,21H,8-11H2,1-2H3/b12-3-/t13-,16?,20?/m0/s1 |
| InChIKey | LCFASSIMOZYFLL-QUNYVJSUSA-N |
| XLogP | 3.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|