C24H24N2O3 — CID 172676953
methyl (1R,11S,12E,17S)-12-ethylidene-4-(furan-3-yl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate (PubChem CID 172676953) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl (1R,11S,12E,17S)-12-ethylidene-4-(furan-3-yl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,11S,12E,17S)-12-ethylidene-4-(furan-3-yl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 172676953 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | methyl (1R,11S,12E,17S)-12-ethylidene-4-(furan-3-yl)-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5,9-tetraene-10-carboxylate |
| SMILES | C/C=C1/CN2CC[C@]34C(=C(C(=O)OC)[C@H]1C[C@H]23)Nc1ccc(-c2ccoc2)cc14 |
| InChI | InChI=1S/C24H24N2O3/c1-3-14-12-26-8-7-24-18-10-15(16-6-9-29-13-16)4-5-19(18)25-22(24)21(23(27)28-2)17(14)11-20(24)26/h3-6,9-10,13,17,20,25H,7-8,11-12H2,1-2H3/b14-3-/t17-,20-,24+/m0/s1 |
| InChIKey | ORZOGXMTJGHUQO-OPXDIOCMSA-N |
| XLogP | 4.09 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|