C20H16F3N3O2S — CID 166671729
2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde (PubChem CID 166671729) has the molecular formula C20H16F3N3O2S and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde.
| Compound Name | 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde |
|---|---|
| PubChem CID | 166671729 |
| Molecular Formula | C20H16F3N3O2S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde |
| SMILES | O=Cc1ccc2nc(N3CCSc4ccccc4C3)nc(OCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C20H16F3N3O2S/c21-20(22,23)12-28-18-15-9-13(11-27)5-6-16(15)24-19(25-18)26-7-8-29-17-4-2-1-3-14(17)10-26/h1-6,9,11H,7-8,10,12H2 |
| InChIKey | OVASVROOOKQJHD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|