C33H34N2O3 — CID 166676476
2,4-diphenyl-4-(2-phenylacetyl)-6,10-diazatricyclo[8.5.0.01,6]pentadecane-3,5-dione (PubChem CID 166676476) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2,4-diphenyl-4-(2-phenylacetyl)-6,10-diazatricyclo[8.5.0.01,6]pentadecane-3,5-dione.
| Compound Name | 2,4-diphenyl-4-(2-phenylacetyl)-6,10-diazatricyclo[8.5.0.01,6]pentadecane-3,5-dione |
|---|---|
| PubChem CID | 166676476 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2,4-diphenyl-4-(2-phenylacetyl)-6,10-diazatricyclo[8.5.0.01,6]pentadecane-3,5-dione |
| SMILES | O=C(Cc1ccccc1)C1(c2ccccc2)C(=O)C(c2ccccc2)C23CCCCCN2CCCN3C1=O |
| InChI | InChI=1S/C33H34N2O3/c36-28(24-25-14-5-1-6-15-25)33(27-18-9-3-10-19-27)30(37)29(26-16-7-2-8-17-26)32-20-11-4-12-21-34(32)22-13-23-35(32)31(33)38/h1-3,5-10,14-19,29H,4,11-13,20-24H2 |
| InChIKey | ULROQYOVBJKPDN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|