C33H64N2O — CID 166678575
1-[9-(2-butylhexyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-pentylnonan-1-one (PubChem CID 166678575) has the molecular formula C33H64N2O and a molecular weight of 504.89 g/mol. Its IUPAC name is 1-[9-(2-butylhexyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-pentylnonan-1-one.
| Compound Name | 1-[9-(2-butylhexyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-pentylnonan-1-one |
|---|---|
| PubChem CID | 166678575 |
| Molecular Formula | C33H64N2O |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 504.50 |
| IUPAC Name | 1-[9-(2-butylhexyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-pentylnonan-1-one |
| SMILES | CCCCCCCC(CCCCC)C(=O)N1CCC2(CCN(CC(CCCC)CCCC)CC2)CC1 |
| InChI | InChI=1S/C33H64N2O/c1-5-9-13-14-16-20-31(19-15-10-6-2)32(36)35-27-23-33(24-28-35)21-25-34(26-22-33)29-30(17-11-7-3)18-12-8-4/h30-31H,5-29H2,1-4H3 |
| InChIKey | TZTWAUOPFUONPA-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|