C25H48N2O — CID 166679050
2-methyl-1-[2-(4-methyloctyl)-2,7-diazaspiro[3.5]nonan-7-yl]octan-1-one (PubChem CID 166679050) has the molecular formula C25H48N2O and a molecular weight of 392.67 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methyloctyl)-2,7-diazaspiro[3.5]nonan-7-yl]octan-1-one.
| Compound Name | 2-methyl-1-[2-(4-methyloctyl)-2,7-diazaspiro[3.5]nonan-7-yl]octan-1-one |
|---|---|
| PubChem CID | 166679050 |
| Molecular Formula | C25H48N2O |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.38 |
| IUPAC Name | 2-methyl-1-[2-(4-methyloctyl)-2,7-diazaspiro[3.5]nonan-7-yl]octan-1-one |
| SMILES | CCCCCCC(C)C(=O)N1CCC2(CC1)CN(CCCC(C)CCCC)C2 |
| InChI | InChI=1S/C25H48N2O/c1-5-7-9-10-14-23(4)24(28)27-18-15-25(16-19-27)20-26(21-25)17-11-13-22(3)12-8-6-2/h22-23H,5-21H2,1-4H3 |
| InChIKey | NSOGFNTWGDBEJX-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|