C23H44N2O — CID 166678947
4-methyl-1-[9-(2-methylheptyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentan-1-one (PubChem CID 166678947) has the molecular formula C23H44N2O and a molecular weight of 364.62 g/mol. Its IUPAC name is 4-methyl-1-[9-(2-methylheptyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentan-1-one.
| Compound Name | 4-methyl-1-[9-(2-methylheptyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 166678947 |
| Molecular Formula | C23H44N2O |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.35 |
| IUPAC Name | 4-methyl-1-[9-(2-methylheptyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentan-1-one |
| SMILES | CCCCCC(C)CN1CCC2(CC1)CCN(C(=O)CCC(C)C)CC2 |
| InChI | InChI=1S/C23H44N2O/c1-5-6-7-8-21(4)19-24-15-11-23(12-16-24)13-17-25(18-14-23)22(26)10-9-20(2)3/h20-21H,5-19H2,1-4H3 |
| InChIKey | VLXVTBUPZSKOER-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|