C22H42N2O — CID 166800540
5-methyl-1-[(1S,5R)-8-(2-methyloctyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]hexan-1-one (PubChem CID 166800540) has the molecular formula C22H42N2O and a molecular weight of 350.59 g/mol. Its IUPAC name is 5-methyl-1-[(1S,5R)-8-(2-methyloctyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]hexan-1-one.
| Compound Name | 5-methyl-1-[(1S,5R)-8-(2-methyloctyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]hexan-1-one |
|---|---|
| PubChem CID | 166800540 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | 5-methyl-1-[(1S,5R)-8-(2-methyloctyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]hexan-1-one |
| SMILES | CCCCCCC(C)CN1[C@@H]2CC[C@H]1CN(C(=O)CCCC(C)C)C2 |
| InChI | InChI=1S/C22H42N2O/c1-5-6-7-8-11-19(4)15-24-20-13-14-21(24)17-23(16-20)22(25)12-9-10-18(2)3/h18-21H,5-17H2,1-4H3/t19?,20-,21+ |
| InChIKey | WTMKOZOMRLLZIN-SEJPIABJSA-N |
| XLogP | 5.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|