About 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one
1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one (PubChem CID 174094814) has the molecular formula C21H42N2O
and a molecular weight of 338.58 g/mol. Its IUPAC name is 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one.
Molecular Properties
| Compound Name | 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one |
| PubChem CID | 174094814 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one |
| SMILES | CCCC(C)CCCC(=O)N1CC(CC)N(CC(C)C)[C@@H](CC)C1 |
| InChI | InChI=1S/C21H42N2O/c1-7-11-18(6)12-10-13-21(24)22-15-19(8-2)23(14-17(4)5)20(9-3)16-22/h17-20H,7-16H2,1-6H3/t18?,19-,20?/m0/s1 |
| InChIKey | IAULWXQYPXCOEC-GPJFCIFZSA-N |
| XLogP | 4.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one?
The IUPAC name of 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one (CID 174094814) is 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one.
What is the SMILES notation for 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one?
The canonical SMILES for 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one is CCCC(C)CCCC(=O)N1CC(CC)N(CC(C)C)[C@@H](CC)C1.
What is the InChIKey of 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one?
The InChIKey is IAULWXQYPXCOEC-GPJFCIFZSA-N. The full InChI is InChI=1S/C21H42N2O/c1-7-11-18(6)12-10-13-21(24)22-15-19(8-2)23(14-17(4)5)20(9-3)16-22/h17-20H,7-16H2,1-6H3/t18?,19-,20?/m0/s1.
What are the key properties of 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one?
1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one has a molecular weight of 338.58 g/mol, XLogP of 4.95, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3,5-diethyl-4-(2-methylpropyl)piperazin-1-yl]-5-methyloctan-1-one is sourced from PubChem (CID 174094814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).