C15H21N3O5S — CID 166680311
2-[[ethyl-[(4-nitrophenyl)methyl]carbamoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 166680311) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[[ethyl-[(4-nitrophenyl)methyl]carbamoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[ethyl-[(4-nitrophenyl)methyl]carbamoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 166680311 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[[ethyl-[(4-nitrophenyl)methyl]carbamoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCN(Cc1ccc([N+](=O)[O-])cc1)C(=O)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C15H21N3O5S/c1-3-17(10-11-4-6-12(7-5-11)18(22)23)15(21)16-13(14(19)20)8-9-24-2/h4-7,13H,3,8-10H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | QKCIGNAKNALGBP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|