C35H35N5O5 — CID 166681512
4-[4-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]piperazin-1-yl]-2-(3-oxopropyl)benzonitrile (PubChem CID 166681512) has the molecular formula C35H35N5O5 and a molecular weight of 605.70 g/mol. Its IUPAC name is 4-[4-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]piperazin-1-yl]-2-(3-oxopropyl)benzonitrile.
| Compound Name | 4-[4-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]piperazin-1-yl]-2-(3-oxopropyl)benzonitrile |
|---|---|
| PubChem CID | 166681512 |
| Molecular Formula | C35H35N5O5 |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 4-[4-[[4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]piperazin-1-yl]-2-(3-oxopropyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(Cc3ccc(COc4cccc5c4CN(C4CCC(=O)NC4=O)C5=O)cc3)CC2)cc1CCC=O |
| InChI | InChI=1S/C35H35N5O5/c36-20-27-10-11-28(19-26(27)3-2-18-41)39-16-14-38(15-17-39)21-24-6-8-25(9-7-24)23-45-32-5-1-4-29-30(32)22-40(35(29)44)31-12-13-33(42)37-34(31)43/h1,4-11,18-19,31H,2-3,12-17,21-23H2,(H,37,42,43) |
| InChIKey | DUXYIPQZPISOOC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|