C7H11NO6 — CID 166683873
(3aR,4R,6R,7R,7aR)-4,7-dihydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one (PubChem CID 166683873) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-4,7-dihydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,4R,6R,7R,7aR)-4,7-dihydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 166683873 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-4,7-dihydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one |
| SMILES | O=C1N[C@@H]2[C@@H](O1)[C@@H](O)[C@@H](CO)O[C@H]2O |
| InChI | InChI=1S/C7H11NO6/c9-1-2-4(10)5-3(6(11)13-2)8-7(12)14-5/h2-6,9-11H,1H2,(H,8,12)/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | JXSFAFMNGZBAJO-VFUOTHLCSA-N |
| XLogP | -2.47 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |