C17H27NO4 — CID 166684702
(2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]methyl]-3-phenylbutanoic acid (PubChem CID 166684702) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]methyl]-3-phenylbutanoic acid.
| Compound Name | (2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]methyl]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 166684702 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]methyl]-3-phenylbutanoic acid |
| SMILES | C[C@@H](c1ccccc1)[C@@H](CN(C)C(O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H27NO4/c1-12(13-9-7-6-8-10-13)14(15(19)20)11-18(5)16(21)22-17(2,3)4/h6-10,12,14,16,21H,11H2,1-5H3,(H,19,20)/t12-,14+,16?/m0/s1 |
| InChIKey | DXKIFSZTTWZETQ-XNVGXSDDSA-N |
| XLogP | 2.51 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|