C16H25NO4 — CID 166696392
(2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]methyl]-3-phenylbutanoic acid (PubChem CID 166696392) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]methyl]-3-phenylbutanoic acid.
| Compound Name | (2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]methyl]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 166696392 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2S,3R)-2-[[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]methyl]-3-phenylbutanoic acid |
| SMILES | C[C@@H](c1ccccc1)[C@@H](CNC(O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H25NO4/c1-11(12-8-6-5-7-9-12)13(14(18)19)10-17-15(20)21-16(2,3)4/h5-9,11,13,15,17,20H,10H2,1-4H3,(H,18,19)/t11-,13+,15?/m0/s1 |
| InChIKey | LOIJHYNTNLSBDB-OZDYYWIQSA-N |
| XLogP | 2.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|