C16H26S — CID 166686523
[3-(2,3-diethylpentyl)phenyl]methanethiol (PubChem CID 166686523) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is [3-(2,3-diethylpentyl)phenyl]methanethiol.
| Compound Name | [3-(2,3-diethylpentyl)phenyl]methanethiol |
|---|---|
| PubChem CID | 166686523 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | [3-(2,3-diethylpentyl)phenyl]methanethiol |
| SMILES | CCC(CC)C(CC)Cc1cccc(CS)c1 |
| InChI | InChI=1S/C16H26S/c1-4-15(5-2)16(6-3)11-13-8-7-9-14(10-13)12-17/h7-10,15-17H,4-6,11-12H2,1-3H3 |
| InChIKey | ZJIMFGAGJZGWTG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|