C16H27NO4 — CID 166688542
3-O-[(Z)-but-2-enyl] 1-O-tert-butyl azepane-1,3-dicarboxylate (PubChem CID 166688542) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-O-[(Z)-but-2-enyl] 1-O-tert-butyl azepane-1,3-dicarboxylate.
| Compound Name | 3-O-[(Z)-but-2-enyl] 1-O-tert-butyl azepane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 166688542 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3-O-[(Z)-but-2-enyl] 1-O-tert-butyl azepane-1,3-dicarboxylate |
| SMILES | C/C=C\COC(=O)C1CCCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27NO4/c1-5-6-11-20-14(18)13-9-7-8-10-17(12-13)15(19)21-16(2,3)4/h5-6,13H,7-12H2,1-4H3/b6-5- |
| InChIKey | MMLFRKOUJPAFGN-WAYWQWQTSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|