C20H32N2O7 — CID 55443009
1-O-tert-butyl 3-O-[2-(4-methoxycarbonylpiperidin-1-yl)-2-oxoethyl] piperidine-1,3-dicarboxylate (PubChem CID 55443009) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[2-(4-methoxycarbonylpiperidin-1-yl)-2-oxoethyl] piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-[2-(4-methoxycarbonylpiperidin-1-yl)-2-oxoethyl] piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55443009 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-O-tert-butyl 3-O-[2-(4-methoxycarbonylpiperidin-1-yl)-2-oxoethyl] piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C20H32N2O7/c1-20(2,3)29-19(26)22-9-5-6-15(12-22)18(25)28-13-16(23)21-10-7-14(8-11-21)17(24)27-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | WSLUNQXYAMBNNA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|