C13H29N5O4S — CID 166688658
2-[[(2S)-2-acetamido-6-aminohexyl]-(2-aminoethylsulfonyl)amino]-N-methylacetamide (PubChem CID 166688658) has the molecular formula C13H29N5O4S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-[[(2S)-2-acetamido-6-aminohexyl]-(2-aminoethylsulfonyl)amino]-N-methylacetamide.
| Compound Name | 2-[[(2S)-2-acetamido-6-aminohexyl]-(2-aminoethylsulfonyl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 166688658 |
| Molecular Formula | C13H29N5O4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-[[(2S)-2-acetamido-6-aminohexyl]-(2-aminoethylsulfonyl)amino]-N-methylacetamide |
| SMILES | CNC(=O)CN(C[C@H](CCCCN)NC(C)=O)S(=O)(=O)CCN |
| InChI | InChI=1S/C13H29N5O4S/c1-11(19)17-12(5-3-4-6-14)9-18(10-13(20)16-2)23(21,22)8-7-15/h12H,3-10,14-15H2,1-2H3,(H,16,20)(H,17,19)/t12-/m0/s1 |
| InChIKey | ACHFFDHOCDFOKP-LBPRGKRZSA-N |
| XLogP | -2.04 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|