C21H31N5O6S — CID 166690527
3-[[2-[4-(butylcarbamoylamino)phenyl]acetyl]amino]-4-oxo-4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]amino]butanoic acid (PubChem CID 166690527) has the molecular formula C21H31N5O6S and a molecular weight of 481.58 g/mol. Its IUPAC name is 3-[[2-[4-(butylcarbamoylamino)phenyl]acetyl]amino]-4-oxo-4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]amino]butanoic acid.
| Compound Name | 3-[[2-[4-(butylcarbamoylamino)phenyl]acetyl]amino]-4-oxo-4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 166690527 |
| Molecular Formula | C21H31N5O6S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-[[2-[4-(butylcarbamoylamino)phenyl]acetyl]amino]-4-oxo-4-[[2-oxo-2-(2-sulfanylethylamino)ethyl]amino]butanoic acid |
| SMILES | CCCCNC(=O)Nc1ccc(CC(=O)NC(CC(=O)O)C(=O)NCC(=O)NCCS)cc1 |
| InChI | InChI=1S/C21H31N5O6S/c1-2-3-8-23-21(32)25-15-6-4-14(5-7-15)11-17(27)26-16(12-19(29)30)20(31)24-13-18(28)22-9-10-33/h4-7,16,33H,2-3,8-13H2,1H3,(H,22,28)(H,24,31)(H,26,27)(H,29,30)(H2,23,25,32) |
| InChIKey | LYZAQABWKQXANM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|