C18H31N3O — CID 166696162
(2S)-1-(6-hexan-2-yloxy-3-pyridinyl)-3-pyrrolidin-1-ylpropan-2-amine (PubChem CID 166696162) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (2S)-1-(6-hexan-2-yloxy-3-pyridinyl)-3-pyrrolidin-1-ylpropan-2-amine.
| Compound Name | (2S)-1-(6-hexan-2-yloxy-3-pyridinyl)-3-pyrrolidin-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 166696162 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (2S)-1-(6-hexan-2-yloxy-3-pyridinyl)-3-pyrrolidin-1-ylpropan-2-amine |
| SMILES | CCCCC(C)Oc1ccc(C[C@H](N)CN2CCCC2)cn1 |
| InChI | InChI=1S/C18H31N3O/c1-3-4-7-15(2)22-18-9-8-16(13-20-18)12-17(19)14-21-10-5-6-11-21/h8-9,13,15,17H,3-7,10-12,14,19H2,1-2H3/t15?,17-/m0/s1 |
| InChIKey | UMMHMXVVDUMYQR-LWKPJOBUSA-N |
| XLogP | 3.00 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |