C21H33N3O — CID 95897061
5-(piperidin-1-ylmethyl)-2-[(2R)-1-pyrrolidin-1-ylhex-5-en-2-yl]oxypyridine (PubChem CID 95897061) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 5-(piperidin-1-ylmethyl)-2-[(2R)-1-pyrrolidin-1-ylhex-5-en-2-yl]oxypyridine.
| Compound Name | 5-(piperidin-1-ylmethyl)-2-[(2R)-1-pyrrolidin-1-ylhex-5-en-2-yl]oxypyridine |
|---|---|
| PubChem CID | 95897061 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 5-(piperidin-1-ylmethyl)-2-[(2R)-1-pyrrolidin-1-ylhex-5-en-2-yl]oxypyridine |
| SMILES | C=CCC[C@H](CN1CCCC1)Oc1ccc(CN2CCCCC2)cn1 |
| InChI | InChI=1S/C21H33N3O/c1-2-3-9-20(18-24-14-7-8-15-24)25-21-11-10-19(16-22-21)17-23-12-5-4-6-13-23/h2,10-11,16,20H,1,3-9,12-15,17-18H2/t20-/m1/s1 |
| InChIKey | NLKKBAVDOMRBKK-HXUWFJFHSA-N |
| XLogP | 3.88 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|