C19H25N3O2 — CID 95862468
4-[(2S)-2-quinoxalin-2-yloxyhex-5-enyl]-1,4-oxazepane (PubChem CID 95862468) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[(2S)-2-quinoxalin-2-yloxyhex-5-enyl]-1,4-oxazepane.
| Compound Name | 4-[(2S)-2-quinoxalin-2-yloxyhex-5-enyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 95862468 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-[(2S)-2-quinoxalin-2-yloxyhex-5-enyl]-1,4-oxazepane |
| SMILES | C=CCC[C@@H](CN1CCCOCC1)Oc1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H25N3O2/c1-2-3-7-16(15-22-10-6-12-23-13-11-22)24-19-14-20-17-8-4-5-9-18(17)21-19/h2,4-5,8-9,14,16H,1,3,6-7,10-13,15H2/t16-/m0/s1 |
| InChIKey | ZYELLUGZOUBPPX-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|