C17H25N3O4 — CID 95867504
1-[(2R)-2-(6-methoxypyrimidin-4-yl)oxyhex-5-enyl]piperidine-4-carboxylic acid (PubChem CID 95867504) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[(2R)-2-(6-methoxypyrimidin-4-yl)oxyhex-5-enyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2R)-2-(6-methoxypyrimidin-4-yl)oxyhex-5-enyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 95867504 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 1-[(2R)-2-(6-methoxypyrimidin-4-yl)oxyhex-5-enyl]piperidine-4-carboxylic acid |
| SMILES | C=CCC[C@H](CN1CCC(C(=O)O)CC1)Oc1cc(OC)ncn1 |
| InChI | InChI=1S/C17H25N3O4/c1-3-4-5-14(24-16-10-15(23-2)18-12-19-16)11-20-8-6-13(7-9-20)17(21)22/h3,10,12-14H,1,4-9,11H2,2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | OFSOKVUMOQBRIS-CQSZACIVSA-N |
| XLogP | 2.00 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|