C15H18IN5 — CID 166696366
7-[3-[(E)-2-(azetidin-1-yl)ethenyl]cyclobutyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 166696366) has the molecular formula C15H18IN5 and a molecular weight of 395.25 g/mol. Its IUPAC name is 7-[3-[(E)-2-(azetidin-1-yl)ethenyl]cyclobutyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-[(E)-2-(azetidin-1-yl)ethenyl]cyclobutyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166696366 |
| Molecular Formula | C15H18IN5 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 7-[3-[(E)-2-(azetidin-1-yl)ethenyl]cyclobutyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(I)cn2C1CC(/C=C/N2CCC2)C1 |
| InChI | InChI=1S/C15H18IN5/c16-12-8-21(15-13(12)14(17)18-9-19-15)11-6-10(7-11)2-5-20-3-1-4-20/h2,5,8-11H,1,3-4,6-7H2,(H2,17,18,19)/b5-2+ |
| InChIKey | SGRSZMDEGVLWCS-GORDUTHDSA-N |
| XLogP | 2.79 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|