C16H22IN5O2S — CID 70975742
7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 70975742) has the molecular formula C16H22IN5O2S and a molecular weight of 475.36 g/mol. Its IUPAC name is 7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70975742 |
| Molecular Formula | C16H22IN5O2S |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)cyclohexyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(I)cn2C1CCC(N2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C16H22IN5O2S/c17-13-9-22(16-14(13)15(18)19-10-20-16)12-3-1-11(2-4-12)21-5-7-25(23,24)8-6-21/h9-12H,1-8H2,(H2,18,19,20) |
| InChIKey | GFVJVHPPYZCKNN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|