C20H30IN5O2 — CID 166748942
tert-butyl 4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2-tert-butylpiperidine-1-carboxylate (PubChem CID 166748942) has the molecular formula C20H30IN5O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2-tert-butylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2-tert-butylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166748942 |
| Molecular Formula | C20H30IN5O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | tert-butyl 4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-2-tert-butylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(I)c3c(N)ncnc32)CC1C(C)(C)C |
| InChI | InChI=1S/C20H30IN5O2/c1-19(2,3)14-9-12(7-8-25(14)18(27)28-20(4,5)6)26-10-13(21)15-16(22)23-11-24-17(15)26/h10-12,14H,7-9H2,1-6H3,(H2,22,23,24) |
| InChIKey | GZPXYCFQWMIYAX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|