C24H31N5O — CID 166698232
7-[(1R,2R,3S,4S)-2,3-dimethyl-4-[(6-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl)oxy]cyclopentyl]-5-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 166698232) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-2,3-dimethyl-4-[(6-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl)oxy]cyclopentyl]-5-methylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(1R,2R,3S,4S)-2,3-dimethyl-4-[(6-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl)oxy]cyclopentyl]-5-methylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166698232 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-2,3-dimethyl-4-[(6-methyl-1,2,3,4-tetrahydroisoquinolin-8-yl)oxy]cyclopentyl]-5-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(c(O[C@H]3C[C@@H](n4cc(C)c5c(N)ncnc54)[C@H](C)[C@@H]3C)c1)CNCC2 |
| InChI | InChI=1S/C24H31N5O/c1-13-7-17-5-6-26-10-18(17)21(8-13)30-20-9-19(15(3)16(20)4)29-11-14(2)22-23(25)27-12-28-24(22)29/h7-8,11-12,15-16,19-20,26H,5-6,9-10H2,1-4H3,(H2,25,27,28)/t15-,16+,19-,20+/m1/s1 |
| InChIKey | IHZCZVYSAYSXDN-GJJHYRHESA-N |
| XLogP | 3.94 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |