C22H24F3N5O3 — CID 166698370
(1S,2S,5S)-3-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[6-(1,1-difluoroethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol (PubChem CID 166698370) has the molecular formula C22H24F3N5O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is (1S,2S,5S)-3-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[6-(1,1-difluoroethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol.
| Compound Name | (1S,2S,5S)-3-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[6-(1,1-difluoroethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 166698370 |
| Molecular Formula | C22H24F3N5O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (1S,2S,5S)-3-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-5-[[6-(1,1-difluoroethyl)-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]cyclopentane-1,2-diol |
| SMILES | CC(F)(F)c1cc2c(c(O[C@H]3CC(n4cc(F)c5c(N)ncnc54)[C@H](O)[C@@H]3O)c1)CNCC2 |
| InChI | InChI=1S/C22H24F3N5O3/c1-22(24,25)11-4-10-2-3-27-7-12(10)15(5-11)33-16-6-14(18(31)19(16)32)30-8-13(23)17-20(26)28-9-29-21(17)30/h4-5,8-9,14,16,18-19,27,31-32H,2-3,6-7H2,1H3,(H2,26,28,29)/t14?,16-,18-,19+/m0/s1 |
| InChIKey | HJXDIXDCZGUOQV-YBIHNIGNSA-N |
| XLogP | 2.02 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |