C26H47NO2 — CID 166698786
4-[(5S,7R,8S,10S,13R,17S)-7-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol (PubChem CID 166698786) has the molecular formula C26H47NO2 and a molecular weight of 405.67 g/mol. Its IUPAC name is 4-[(5S,7R,8S,10S,13R,17S)-7-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol.
| Compound Name | 4-[(5S,7R,8S,10S,13R,17S)-7-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol |
|---|---|
| PubChem CID | 166698786 |
| Molecular Formula | C26H47NO2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.36 |
| IUPAC Name | 4-[(5S,7R,8S,10S,13R,17S)-7-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol |
| SMILES | C[C@]12CCC3[C@H](C1CC[C@@H]2CCCCO)[C@H](OCCCN)C[C@@H]1CCCC[C@]31C |
| InChI | InChI=1S/C26H47NO2/c1-25-13-5-3-9-20(25)18-23(29-17-7-15-27)24-21-11-10-19(8-4-6-16-28)26(21,2)14-12-22(24)25/h19-24,28H,3-18,27H2,1-2H3/t19-,20-,21?,22?,23+,24-,25-,26+/m0/s1 |
| InChIKey | XYXXPBRRAJGKOC-VMSSRAKWSA-N |
| XLogP | 5.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|