C18H18N4O3S — CID 16669894
2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[2-(furan-2-yl)ethyl]acetamide (PubChem CID 16669894) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[2-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[2-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 16669894 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-(4,12-dimethyl-9-oxo-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)-N-[2-(furan-2-yl)ethyl]acetamide |
| SMILES | Cc1cc2c(cc3c(=O)n(CC(=O)NCCc4ccco4)nc(C)n32)s1 |
| InChI | InChI=1S/C18H18N4O3S/c1-11-8-14-16(26-11)9-15-18(24)21(20-12(2)22(14)15)10-17(23)19-6-5-13-4-3-7-25-13/h3-4,7-9H,5-6,10H2,1-2H3,(H,19,23) |
| InChIKey | WBTSOWZIYGAFIR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |