C15H25N — CID 166701743
1-cyclohexyl-10-azatricyclo[4.3.1.02,4]decane (PubChem CID 166701743) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-cyclohexyl-10-azatricyclo[4.3.1.02,4]decane.
| Compound Name | 1-cyclohexyl-10-azatricyclo[4.3.1.02,4]decane |
|---|---|
| PubChem CID | 166701743 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-cyclohexyl-10-azatricyclo[4.3.1.02,4]decane |
| SMILES | C1CCC(C23CCCC(CC4CC42)N3)CC1 |
| InChI | InChI=1S/C15H25N/c1-2-5-12(6-3-1)15-8-4-7-13(16-15)9-11-10-14(11)15/h11-14,16H,1-10H2 |
| InChIKey | FYAGGVYHVTUHIM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |