C10H14 — CID 163768070
(1S,2S)-tetracyclo[4.4.0.01,7.02,4]decane (PubChem CID 163768070) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (1S,2S)-tetracyclo[4.4.0.01,7.02,4]decane.
| Compound Name | (1S,2S)-tetracyclo[4.4.0.01,7.02,4]decane |
|---|---|
| PubChem CID | 163768070 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (1S,2S)-tetracyclo[4.4.0.01,7.02,4]decane |
| SMILES | C1CC2C3CC4C[C@@H]4[C@@]23C1 |
| InChI | InChI=1S/C10H14/c1-2-7-9-5-6-4-8(6)10(7,9)3-1/h6-9H,1-5H2/t6?,7?,8-,9?,10+/m0/s1 |
| InChIKey | MEBFQBAVHGWABR-GEZSGWCBSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |