C19H10N2O2S2 — CID 166703958
(5E)-5-[(5-pyrrolo[2,3-b]pyridin-1-ylthiophen-2-yl)methylidene]cyclopenta[b]thiophene-4,6-dione (PubChem CID 166703958) has the molecular formula C19H10N2O2S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is (5E)-5-[(5-pyrrolo[2,3-b]pyridin-1-ylthiophen-2-yl)methylidene]cyclopenta[b]thiophene-4,6-dione.
| Compound Name | (5E)-5-[(5-pyrrolo[2,3-b]pyridin-1-ylthiophen-2-yl)methylidene]cyclopenta[b]thiophene-4,6-dione |
|---|---|
| PubChem CID | 166703958 |
| Molecular Formula | C19H10N2O2S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (5E)-5-[(5-pyrrolo[2,3-b]pyridin-1-ylthiophen-2-yl)methylidene]cyclopenta[b]thiophene-4,6-dione |
| SMILES | O=C1/C(=C\c2ccc(-n3ccc4cccnc43)s2)C(=O)c2sccc21 |
| InChI | InChI=1S/C19H10N2O2S2/c22-16-13-6-9-24-18(13)17(23)14(16)10-12-3-4-15(25-12)21-8-5-11-2-1-7-20-19(11)21/h1-10H/b14-10+ |
| InChIKey | XWYFHYBVYGFPJA-GXDHUFHOSA-N |
| XLogP | 4.61 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|